About 4-methoxy-2,3-dimethylthiophene
4-methoxy-2,3-dimethylthiophene (PubChem CID 13061861) has the molecular formula C7H10OS
and a molecular weight of 142.22 g/mol. Its IUPAC name is 4-methoxy-2,3-dimethylthiophene.
Molecular Properties
| Compound Name | 4-methoxy-2,3-dimethylthiophene |
| PubChem CID | 13061861 |
| Molecular Formula | C7H10OS |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 4-methoxy-2,3-dimethylthiophene |
| SMILES | COc1csc(C)c1C |
| InChI | InChI=1S/C7H10OS/c1-5-6(2)9-4-7(5)8-3/h4H,1-3H3 |
| InChIKey | HSHFEJHWWLAOIU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-2,3-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,3-dimethylthiophene?
The IUPAC name of 4-methoxy-2,3-dimethylthiophene (CID 13061861) is 4-methoxy-2,3-dimethylthiophene.
What is the SMILES notation for 4-methoxy-2,3-dimethylthiophene?
The canonical SMILES for 4-methoxy-2,3-dimethylthiophene is COc1csc(C)c1C.
What is the InChIKey of 4-methoxy-2,3-dimethylthiophene?
The InChIKey is HSHFEJHWWLAOIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10OS/c1-5-6(2)9-4-7(5)8-3/h4H,1-3H3.
What are the key properties of 4-methoxy-2,3-dimethylthiophene?
4-methoxy-2,3-dimethylthiophene has a molecular weight of 142.22 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3-dimethylthiophene is sourced from PubChem (CID 13061861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).