C10H18N2O2 — CID 130619161
3-(1,4-dioxepan-6-ylamino)-2-methylbutanenitrile (PubChem CID 130619161) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-(1,4-dioxepan-6-ylamino)-2-methylbutanenitrile.
| Compound Name | 3-(1,4-dioxepan-6-ylamino)-2-methylbutanenitrile |
|---|---|
| PubChem CID | 130619161 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-(1,4-dioxepan-6-ylamino)-2-methylbutanenitrile |
| SMILES | CC(C#N)C(C)NC1COCCOC1 |
| InChI | InChI=1S/C10H18N2O2/c1-8(5-11)9(2)12-10-6-13-3-4-14-7-10/h8-10,12H,3-4,6-7H2,1-2H3 |
| InChIKey | PNKOYIAJUCEDAR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |