About (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol
(3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol (PubChem CID 130619969) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol.
Molecular Properties
| Compound Name | (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol |
| PubChem CID | 130619969 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol |
| SMILES | CCc1ccc(O)c2c1[C@@H](N)CO2 |
| InChI | InChI=1S/C10H13NO2/c1-2-6-3-4-8(12)10-9(6)7(11)5-13-10/h3-4,7,12H,2,5,11H2,1H3/t7-/m0/s1 |
| InChIKey | ZHCJLXYGPSJRTK-ZETCQYMHSA-N |
| XLogP | 1.35 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol?
The IUPAC name of (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol (CID 130619969) is (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol.
What is the SMILES notation for (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol?
The canonical SMILES for (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol is CCc1ccc(O)c2c1[C@@H](N)CO2.
What is the InChIKey of (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol?
The InChIKey is ZHCJLXYGPSJRTK-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H13NO2/c1-2-6-3-4-8(12)10-9(6)7(11)5-13-10/h3-4,7,12H,2,5,11H2,1H3/t7-/m0/s1.
What are the key properties of (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol?
(3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol has a molecular weight of 179.22 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-4-ethyl-2,3-dihydro-1-benzofuran-7-ol is sourced from PubChem (CID 130619969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).