About 2,3-dihydro-1,4-dioxin-5-ylmethylurea
2,3-dihydro-1,4-dioxin-5-ylmethylurea (PubChem CID 130620102) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is 2,3-dihydro-1,4-dioxin-5-ylmethylurea.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-dioxin-5-ylmethylurea |
| PubChem CID | 130620102 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 2,3-dihydro-1,4-dioxin-5-ylmethylurea |
| SMILES | NC(=O)NCC1=COCCO1 |
| InChI | InChI=1S/C6H10N2O3/c7-6(9)8-3-5-4-10-1-2-11-5/h4H,1-3H2,(H3,7,8,9) |
| InChIKey | MCBOQQTXNAJPNE-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1,4-dioxin-5-ylmethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-dioxin-5-ylmethylurea?
The IUPAC name of 2,3-dihydro-1,4-dioxin-5-ylmethylurea (CID 130620102) is 2,3-dihydro-1,4-dioxin-5-ylmethylurea.
What is the SMILES notation for 2,3-dihydro-1,4-dioxin-5-ylmethylurea?
The canonical SMILES for 2,3-dihydro-1,4-dioxin-5-ylmethylurea is NC(=O)NCC1=COCCO1.
What is the InChIKey of 2,3-dihydro-1,4-dioxin-5-ylmethylurea?
The InChIKey is MCBOQQTXNAJPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c7-6(9)8-3-5-4-10-1-2-11-5/h4H,1-3H2,(H3,7,8,9).
What are the key properties of 2,3-dihydro-1,4-dioxin-5-ylmethylurea?
2,3-dihydro-1,4-dioxin-5-ylmethylurea has a molecular weight of 158.16 g/mol, XLogP of -0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-dioxin-5-ylmethylurea is sourced from PubChem (CID 130620102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).