C8H10N2O2 — CID 130620155
N-[2-(cyclopropylamino)-2-oxoethyl]prop-2-ynamide (PubChem CID 130620155) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]prop-2-ynamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]prop-2-ynamide |
|---|---|
| PubChem CID | 130620155 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]prop-2-ynamide |
| SMILES | C#CC(=O)NCC(=O)NC1CC1 |
| InChI | InChI=1S/C8H10N2O2/c1-2-7(11)9-5-8(12)10-6-3-4-6/h1,6H,3-5H2,(H,9,11)(H,10,12) |
| InChIKey | BZVRYSBIMYLBIN-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|