About 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine
6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine (PubChem CID 130620159) has the molecular formula C9H11FN4
and a molecular weight of 194.21 g/mol. Its IUPAC name is 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine |
| PubChem CID | 130620159 |
| Molecular Formula | C9H11FN4 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine |
| SMILES | Nc1cncc(N2CCC=C(F)C2)n1 |
| InChI | InChI=1S/C9H11FN4/c10-7-2-1-3-14(6-7)9-5-12-4-8(11)13-9/h2,4-5H,1,3,6H2,(H2,11,13) |
| InChIKey | VCRHILDWPRUJSG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine?
The IUPAC name of 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine (CID 130620159) is 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine.
What is the SMILES notation for 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine?
The canonical SMILES for 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine is Nc1cncc(N2CCC=C(F)C2)n1.
What is the InChIKey of 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine?
The InChIKey is VCRHILDWPRUJSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN4/c10-7-2-1-3-14(6-7)9-5-12-4-8(11)13-9/h2,4-5H,1,3,6H2,(H2,11,13).
What are the key properties of 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine?
6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine has a molecular weight of 194.21 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine is sourced from PubChem (CID 130620159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).