C10H13NO — CID 130621125
N-cyclohex-3-en-1-ylbut-2-ynamide (PubChem CID 130621125) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is N-cyclohex-3-en-1-ylbut-2-ynamide.
| Compound Name | N-cyclohex-3-en-1-ylbut-2-ynamide |
|---|---|
| PubChem CID | 130621125 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N-cyclohex-3-en-1-ylbut-2-ynamide |
| SMILES | CC#CC(=O)NC1CC=CCC1 |
| InChI | InChI=1S/C10H13NO/c1-2-6-10(12)11-9-7-4-3-5-8-9/h3-4,9H,5,7-8H2,1H3,(H,11,12) |
| InChIKey | XOBWODWQTHYHOI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|