About N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide
N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide (PubChem CID 130621359) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide.
Molecular Properties
| Compound Name | N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide |
| PubChem CID | 130621359 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide |
| SMILES | CC(C#N)NC(=O)C1=CCOCC1 |
| InChI | InChI=1S/C9H12N2O2/c1-7(6-10)11-9(12)8-2-4-13-5-3-8/h2,7H,3-5H2,1H3,(H,11,12) |
| InChIKey | DWDWIMIKXHTNHQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide?
The IUPAC name of N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide (CID 130621359) is N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide.
What is the SMILES notation for N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide?
The canonical SMILES for N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide is CC(C#N)NC(=O)C1=CCOCC1.
What is the InChIKey of N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide?
The InChIKey is DWDWIMIKXHTNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-7(6-10)11-9(12)8-2-4-13-5-3-8/h2,7H,3-5H2,1H3,(H,11,12).
What are the key properties of N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide?
N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide has a molecular weight of 180.21 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanoethyl)-3,6-dihydro-2H-pyran-4-carboxamide is sourced from PubChem (CID 130621359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).