About 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea
1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea (PubChem CID 130621364) has the molecular formula C8H16N2O3
and a molecular weight of 188.23 g/mol. Its IUPAC name is 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea |
| PubChem CID | 130621364 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea |
| SMILES | CCNC(=O)NCC1(C)OCCO1 |
| InChI | InChI=1S/C8H16N2O3/c1-3-9-7(11)10-6-8(2)12-4-5-13-8/h3-6H2,1-2H3,(H2,9,10,11) |
| InChIKey | WJIPLIJBMOZBPI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea?
The IUPAC name of 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea (CID 130621364) is 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea.
What is the SMILES notation for 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea?
The canonical SMILES for 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea is CCNC(=O)NCC1(C)OCCO1.
What is the InChIKey of 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea?
The InChIKey is WJIPLIJBMOZBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3/c1-3-9-7(11)10-6-8(2)12-4-5-13-8/h3-6H2,1-2H3,(H2,9,10,11).
What are the key properties of 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea?
1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea has a molecular weight of 188.23 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]urea is sourced from PubChem (CID 130621364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).