About N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide
N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide (PubChem CID 130621546) has the molecular formula C7H9FN2OS
and a molecular weight of 188.23 g/mol. Its IUPAC name is N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide |
| PubChem CID | 130621546 |
| Molecular Formula | C7H9FN2OS |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ncc(F)s1 |
| InChI | InChI=1S/C7H9FN2OS/c1-4(2)6(11)10-7-9-3-5(8)12-7/h3-4H,1-2H3,(H,9,10,11) |
| InChIKey | CLWBPWZHAQOJLL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide?
The IUPAC name of N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide (CID 130621546) is N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide.
What is the SMILES notation for N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide?
The canonical SMILES for N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide is CC(C)C(=O)Nc1ncc(F)s1.
What is the InChIKey of N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide?
The InChIKey is CLWBPWZHAQOJLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2OS/c1-4(2)6(11)10-7-9-3-5(8)12-7/h3-4H,1-2H3,(H,9,10,11).
What are the key properties of N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide?
N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide has a molecular weight of 188.23 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-fluoro-1,3-thiazol-2-yl)-2-methylpropanamide is sourced from PubChem (CID 130621546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).