About [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone
[(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone (PubChem CID 130621724) has the molecular formula C10H17FN2O
and a molecular weight of 200.26 g/mol. Its IUPAC name is [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone.
Molecular Properties
| Compound Name | [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone |
| PubChem CID | 130621724 |
| Molecular Formula | C10H17FN2O |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone |
| SMILES | CC1CC1C(=O)N1C[C@@H](F)C[C@H]1CN |
| InChI | InChI=1S/C10H17FN2O/c1-6-2-9(6)10(14)13-5-7(11)3-8(13)4-12/h6-9H,2-5,12H2,1H3/t6?,7-,8-,9?/m0/s1 |
| InChIKey | RGGZCXDPQFDIFH-QXNPHUFVSA-N |
| XLogP | 0.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone?
The IUPAC name of [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone (CID 130621724) is [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone.
What is the SMILES notation for [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone?
The canonical SMILES for [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone is CC1CC1C(=O)N1C[C@@H](F)C[C@H]1CN.
What is the InChIKey of [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone?
The InChIKey is RGGZCXDPQFDIFH-QXNPHUFVSA-N. The full InChI is InChI=1S/C10H17FN2O/c1-6-2-9(6)10(14)13-5-7(11)3-8(13)4-12/h6-9H,2-5,12H2,1H3/t6?,7-,8-,9?/m0/s1.
What are the key properties of [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone?
[(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone has a molecular weight of 200.26 g/mol, XLogP of 0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-2-(aminomethyl)-4-fluoropyrrolidin-1-yl]-(2-methylcyclopropyl)methanone is sourced from PubChem (CID 130621724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).