About 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine
2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine (PubChem CID 130621882) has the molecular formula C7H6ClN3OS
and a molecular weight of 215.67 g/mol. Its IUPAC name is 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine |
| PubChem CID | 130621882 |
| Molecular Formula | C7H6ClN3OS |
| Molecular Weight | 215.67 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine |
| SMILES | Clc1nc(NCc2cocn2)cs1 |
| InChI | InChI=1S/C7H6ClN3OS/c8-7-11-6(3-13-7)9-1-5-2-12-4-10-5/h2-4,9H,1H2 |
| InChIKey | UMPYTDYKWPQYTL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.67 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine?
The IUPAC name of 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine (CID 130621882) is 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine.
What is the SMILES notation for 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine?
The canonical SMILES for 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine is Clc1nc(NCc2cocn2)cs1.
What is the InChIKey of 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine?
The InChIKey is UMPYTDYKWPQYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3OS/c8-7-11-6(3-13-7)9-1-5-2-12-4-10-5/h2-4,9H,1H2.
What are the key properties of 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine?
2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine has a molecular weight of 215.67 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-4-amine is sourced from PubChem (CID 130621882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).