About (6R)-6-fluorooct-7-enal
(6R)-6-fluorooct-7-enal (PubChem CID 130623208) has the molecular formula C8H13FO
and a molecular weight of 144.19 g/mol. Its IUPAC name is (6R)-6-fluorooct-7-enal.
Molecular Properties
| Compound Name | (6R)-6-fluorooct-7-enal |
| PubChem CID | 130623208 |
| Molecular Formula | C8H13FO |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (6R)-6-fluorooct-7-enal |
| SMILES | C=C[C@H](F)CCCCC=O |
| InChI | InChI=1S/C8H13FO/c1-2-8(9)6-4-3-5-7-10/h2,7-8H,1,3-6H2/t8-/m0/s1 |
| InChIKey | GRZQOKXGRQXOIO-QMMMGPOBSA-N |
| XLogP | 2.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-fluorooct-7-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-fluorooct-7-enal?
The IUPAC name of (6R)-6-fluorooct-7-enal (CID 130623208) is (6R)-6-fluorooct-7-enal.
What is the SMILES notation for (6R)-6-fluorooct-7-enal?
The canonical SMILES for (6R)-6-fluorooct-7-enal is C=C[C@H](F)CCCCC=O.
What is the InChIKey of (6R)-6-fluorooct-7-enal?
The InChIKey is GRZQOKXGRQXOIO-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H13FO/c1-2-8(9)6-4-3-5-7-10/h2,7-8H,1,3-6H2/t8-/m0/s1.
What are the key properties of (6R)-6-fluorooct-7-enal?
(6R)-6-fluorooct-7-enal has a molecular weight of 144.19 g/mol, XLogP of 2.27, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-fluorooct-7-enal is sourced from PubChem (CID 130623208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).