About 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide
1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide (PubChem CID 130623589) has the molecular formula C5H10BrNO4S
and a molecular weight of 260.11 g/mol. Its IUPAC name is 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide |
| PubChem CID | 130623589 |
| Molecular Formula | C5H10BrNO4S |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide |
| SMILES | O=S(=O)(CBr)N[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C5H10BrNO4S/c6-3-12(9,10)7-4-1-11-2-5(4)8/h4-5,7-8H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | IZAKTERJVVJVRB-RFZPGFLSSA-N |
| XLogP | -0.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide?
The IUPAC name of 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide (CID 130623589) is 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide.
What is the SMILES notation for 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide?
The canonical SMILES for 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide is O=S(=O)(CBr)N[C@@H]1COC[C@H]1O.
What is the InChIKey of 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide?
The InChIKey is IZAKTERJVVJVRB-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H10BrNO4S/c6-3-12(9,10)7-4-1-11-2-5(4)8/h4-5,7-8H,1-3H2/t4-,5-/m1/s1.
What are the key properties of 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide?
1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide has a molecular weight of 260.11 g/mol, XLogP of -0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide is sourced from PubChem (CID 130623589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).