C8H8F2N2O2 — CID 130623975
(1R)-1-(2,6-difluoro-3-nitrophenyl)ethanamine (PubChem CID 130623975) has the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. Its IUPAC name is (1R)-1-(2,6-difluoro-3-nitrophenyl)ethanamine.
| Compound Name | (1R)-1-(2,6-difluoro-3-nitrophenyl)ethanamine |
|---|---|
| PubChem CID | 130623975 |
| Molecular Formula | C8H8F2N2O2 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (1R)-1-(2,6-difluoro-3-nitrophenyl)ethanamine |
| SMILES | C[C@@H](N)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C8H8F2N2O2/c1-4(11)7-5(9)2-3-6(8(7)10)12(13)14/h2-4H,11H2,1H3/t4-/m1/s1 |
| InChIKey | RTRZOHBNAGVNOB-SCSAIBSYSA-N |
| XLogP | 1.89 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|