C10H19F2NO — CID 130624309
4-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-2-ol (PubChem CID 130624309) has the molecular formula C10H19F2NO and a molecular weight of 207.26 g/mol. Its IUPAC name is 4-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-2-ol.
| Compound Name | 4-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 130624309 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-2-ol |
| SMILES | CC(O)C(C)(C)CN1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H19F2NO/c1-8(14)9(2,3)6-13-5-4-10(11,12)7-13/h8,14H,4-7H2,1-3H3 |
| InChIKey | RJVKDZKFIUTWRP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |