About 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide
3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide (PubChem CID 130624603) has the molecular formula C8H16N4O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide.
Molecular Properties
| Compound Name | 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide |
| PubChem CID | 130624603 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide |
| SMILES | CN1CCCN(CCC(=O)NN)C1=O |
| InChI | InChI=1S/C8H16N4O2/c1-11-4-2-5-12(8(11)14)6-3-7(13)10-9/h2-6,9H2,1H3,(H,10,13) |
| InChIKey | SFNWNGWIKDEPCD-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide?
The IUPAC name of 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide (CID 130624603) is 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide.
What is the SMILES notation for 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide?
The canonical SMILES for 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide is CN1CCCN(CCC(=O)NN)C1=O.
What is the InChIKey of 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide?
The InChIKey is SFNWNGWIKDEPCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O2/c1-11-4-2-5-12(8(11)14)6-3-7(13)10-9/h2-6,9H2,1H3,(H,10,13).
What are the key properties of 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide?
3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide has a molecular weight of 200.24 g/mol, XLogP of -0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-2-oxo-1,3-diazinan-1-yl)propanehydrazide is sourced from PubChem (CID 130624603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).