About (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol
(3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol (PubChem CID 130624664) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 130624664 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol |
| SMILES | N[C@H]1CCc2cc(Br)c(O)cc21 |
| InChI | InChI=1S/C9H10BrNO/c10-7-3-5-1-2-8(11)6(5)4-9(7)12/h3-4,8,12H,1-2,11H2/t8-/m0/s1 |
| InChIKey | ZJYOGFXMOVMHIX-QMMMGPOBSA-N |
| XLogP | 2.10 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol (CID 130624664) is (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol is N[C@H]1CCc2cc(Br)c(O)cc21.
What is the InChIKey of (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol?
The InChIKey is ZJYOGFXMOVMHIX-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H10BrNO/c10-7-3-5-1-2-8(11)6(5)4-9(7)12/h3-4,8,12H,1-2,11H2/t8-/m0/s1.
What are the key properties of (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol?
(3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol has a molecular weight of 228.09 g/mol, XLogP of 2.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-6-bromo-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 130624664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).