C11H9BrClNO — CID 130624755
5-(2-bromo-6-methylphenyl)-2-(chloromethyl)-1,3-oxazole (PubChem CID 130624755) has the molecular formula C11H9BrClNO and a molecular weight of 286.56 g/mol. Its IUPAC name is 5-(2-bromo-6-methylphenyl)-2-(chloromethyl)-1,3-oxazole.
| Compound Name | 5-(2-bromo-6-methylphenyl)-2-(chloromethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 130624755 |
| Molecular Formula | C11H9BrClNO |
| Molecular Weight | 286.56 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 5-(2-bromo-6-methylphenyl)-2-(chloromethyl)-1,3-oxazole |
| SMILES | Cc1cccc(Br)c1-c1cnc(CCl)o1 |
| InChI | InChI=1S/C11H9BrClNO/c1-7-3-2-4-8(12)11(7)9-6-14-10(5-13)15-9/h2-4,6H,5H2,1H3 |
| InChIKey | AKEGGGGMMLYBGH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|