About (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol
(2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol (PubChem CID 130624818) has the molecular formula C7H8Cl2N2O
and a molecular weight of 207.06 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol.
Molecular Properties
| Compound Name | (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol |
| PubChem CID | 130624818 |
| Molecular Formula | C7H8Cl2N2O |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol |
| SMILES | N[C@@H](CO)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C7H8Cl2N2O/c8-6-1-4(5(10)3-12)2-7(9)11-6/h1-2,5,12H,3,10H2/t5-/m0/s1 |
| InChIKey | QQVSQDCHSZYGSS-YFKPBYRVSA-N |
| XLogP | 1.38 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol?
The IUPAC name of (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol (CID 130624818) is (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol.
What is the SMILES notation for (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol?
The canonical SMILES for (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol is N[C@@H](CO)c1cc(Cl)nc(Cl)c1.
What is the InChIKey of (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol?
The InChIKey is QQVSQDCHSZYGSS-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H8Cl2N2O/c8-6-1-4(5(10)3-12)2-7(9)11-6/h1-2,5,12H,3,10H2/t5-/m0/s1.
What are the key properties of (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol?
(2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol has a molecular weight of 207.06 g/mol, XLogP of 1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-(2,6-dichloro-4-pyridinyl)ethanol is sourced from PubChem (CID 130624818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).