About but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate
but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate (PubChem CID 13062575) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate.
Molecular Properties
| Compound Name | but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate |
| PubChem CID | 13062575 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate |
| SMILES | C=CCCOC(=O)CC1=CC=CC1 |
| InChI | InChI=1S/C11H14O2/c1-2-3-8-13-11(12)9-10-6-4-5-7-10/h2,4-6H,1,3,7-9H2 |
| InChIKey | UIRUFDPFRRPMGW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate?
The IUPAC name of but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate (CID 13062575) is but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate.
What is the SMILES notation for but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate?
The canonical SMILES for but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate is C=CCCOC(=O)CC1=CC=CC1.
What is the InChIKey of but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate?
The InChIKey is UIRUFDPFRRPMGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-2-3-8-13-11(12)9-10-6-4-5-7-10/h2,4-6H,1,3,7-9H2.
What are the key properties of but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate?
but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate has a molecular weight of 178.23 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 2-cyclopenta-1,3-dien-1-ylacetate is sourced from PubChem (CID 13062575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).