About 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide
2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 130626079) has the molecular formula C6H14IN3O2S
and a molecular weight of 319.17 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide |
| PubChem CID | 130626079 |
| Molecular Formula | C6H14IN3O2S |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | I.NC(N)=NCCC1CS(=O)(=O)C1 |
| InChI | InChI=1S/C6H13N3O2S.HI/c7-6(8)9-2-1-5-3-12(10,11)4-5;/h5H,1-4H2,(H4,7,8,9);1H |
| InChIKey | XMCKPQPOKJFHOG-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide?
The IUPAC name of 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide (CID 130626079) is 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide.
What is the SMILES notation for 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide?
The canonical SMILES for 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide is I.NC(N)=NCCC1CS(=O)(=O)C1.
What is the InChIKey of 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide?
The InChIKey is XMCKPQPOKJFHOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O2S.HI/c7-6(8)9-2-1-5-3-12(10,11)4-5;/h5H,1-4H2,(H4,7,8,9);1H.
What are the key properties of 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide?
2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide has a molecular weight of 319.17 g/mol, XLogP of -0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,1-dioxothietan-3-yl)ethyl]guanidine;hydroiodide is sourced from PubChem (CID 130626079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).