C8H10BrF2NO — CID 130626238
N-(2-bicyclo[3.1.0]hexanyl)-2-bromo-2,2-difluoroacetamide (PubChem CID 130626238) has the molecular formula C8H10BrF2NO and a molecular weight of 254.07 g/mol. Its IUPAC name is N-(2-bicyclo[3.1.0]hexanyl)-2-bromo-2,2-difluoroacetamide.
| Compound Name | N-(2-bicyclo[3.1.0]hexanyl)-2-bromo-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 130626238 |
| Molecular Formula | C8H10BrF2NO |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | N-(2-bicyclo[3.1.0]hexanyl)-2-bromo-2,2-difluoroacetamide |
| SMILES | O=C(NC1CCC2CC21)C(F)(F)Br |
| InChI | InChI=1S/C8H10BrF2NO/c9-8(10,11)7(13)12-6-2-1-4-3-5(4)6/h4-6H,1-3H2,(H,12,13) |
| InChIKey | ZGAASVORTKADCU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|