About 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea
1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea (PubChem CID 130626503) has the molecular formula C9H16N2OS
and a molecular weight of 200.31 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea.
Molecular Properties
| Compound Name | 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea |
| PubChem CID | 130626503 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea |
| SMILES | CCNC(=S)NCC1=CCCOC1 |
| InChI | InChI=1S/C9H16N2OS/c1-2-10-9(13)11-6-8-4-3-5-12-7-8/h4H,2-3,5-7H2,1H3,(H2,10,11,13) |
| InChIKey | AQDADIVDDWSBJW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea?
The IUPAC name of 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea (CID 130626503) is 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea.
What is the SMILES notation for 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea?
The canonical SMILES for 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea is CCNC(=S)NCC1=CCCOC1.
What is the InChIKey of 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea?
The InChIKey is AQDADIVDDWSBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2OS/c1-2-10-9(13)11-6-8-4-3-5-12-7-8/h4H,2-3,5-7H2,1H3,(H2,10,11,13).
What are the key properties of 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea?
1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea has a molecular weight of 200.31 g/mol, XLogP of 0.82, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylthiourea is sourced from PubChem (CID 130626503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).