C10H18FNS — CID 130626687
4-(2-fluoroethyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine (PubChem CID 130626687) has the molecular formula C10H18FNS and a molecular weight of 203.33 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine.
| Compound Name | 4-(2-fluoroethyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine |
|---|---|
| PubChem CID | 130626687 |
| Molecular Formula | C10H18FNS |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-(2-fluoroethyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine |
| SMILES | FCCN1CCSC2CCCCC21 |
| InChI | InChI=1S/C10H18FNS/c11-5-6-12-7-8-13-10-4-2-1-3-9(10)12/h9-10H,1-8H2 |
| InChIKey | HSFKLQXHHYIYFB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |