About 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine
3-cyclohexylsulfanyl-1,2,4-triazol-4-amine (PubChem CID 130626697) has the molecular formula C8H14N4S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine |
| PubChem CID | 130626697 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine |
| SMILES | Nn1cnnc1SC1CCCCC1 |
| InChI | InChI=1S/C8H14N4S/c9-12-6-10-11-8(12)13-7-4-2-1-3-5-7/h6-7H,1-5,9H2 |
| InChIKey | XWYBWJAJRBQMDQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine?
The IUPAC name of 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine (CID 130626697) is 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine.
What is the SMILES notation for 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine?
The canonical SMILES for 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine is Nn1cnnc1SC1CCCCC1.
What is the InChIKey of 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine?
The InChIKey is XWYBWJAJRBQMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4S/c9-12-6-10-11-8(12)13-7-4-2-1-3-5-7/h6-7H,1-5,9H2.
What are the key properties of 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine?
3-cyclohexylsulfanyl-1,2,4-triazol-4-amine has a molecular weight of 198.29 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylsulfanyl-1,2,4-triazol-4-amine is sourced from PubChem (CID 130626697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).