C9H17FN2O — CID 130627637
6-(2-fluoroethyl)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 130627637) has the molecular formula C9H17FN2O and a molecular weight of 188.25 g/mol. Its IUPAC name is 6-(2-fluoroethyl)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | 6-(2-fluoroethyl)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 130627637 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 6-(2-fluoroethyl)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CN1CCOC2CN(CCF)CC21 |
| InChI | InChI=1S/C9H17FN2O/c1-11-4-5-13-9-7-12(3-2-10)6-8(9)11/h8-9H,2-7H2,1H3 |
| InChIKey | ZECJABAKHPQASG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |