About N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide
N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide (PubChem CID 130627868) has the molecular formula C8H7ClN2OS
and a molecular weight of 214.68 g/mol. Its IUPAC name is N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide |
| PubChem CID | 130627868 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide |
| SMILES | CC#CCNC(=O)c1nc(Cl)cs1 |
| InChI | InChI=1S/C8H7ClN2OS/c1-2-3-4-10-7(12)8-11-6(9)5-13-8/h5H,4H2,1H3,(H,10,12) |
| InChIKey | HDIPRRVEJFKGQG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide?
The IUPAC name of N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide (CID 130627868) is N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide is CC#CCNC(=O)c1nc(Cl)cs1.
What is the InChIKey of N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide?
The InChIKey is HDIPRRVEJFKGQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2OS/c1-2-3-4-10-7(12)8-11-6(9)5-13-8/h5H,4H2,1H3,(H,10,12).
What are the key properties of N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide?
N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide has a molecular weight of 214.68 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-2-ynyl-4-chloro-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 130627868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).