About N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide
N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide (PubChem CID 130628533) has the molecular formula C7H11F2NO2S
and a molecular weight of 211.23 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide |
| PubChem CID | 130628533 |
| Molecular Formula | C7H11F2NO2S |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide |
| SMILES | O=S(=O)(NC1C=CCCC1)C(F)F |
| InChI | InChI=1S/C7H11F2NO2S/c8-7(9)13(11,12)10-6-4-2-1-3-5-6/h2,4,6-7,10H,1,3,5H2 |
| InChIKey | PSFGMSCLDPRYGF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide?
The IUPAC name of N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide (CID 130628533) is N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide.
What is the SMILES notation for N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide?
The canonical SMILES for N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide is O=S(=O)(NC1C=CCCC1)C(F)F.
What is the InChIKey of N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide?
The InChIKey is PSFGMSCLDPRYGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO2S/c8-7(9)13(11,12)10-6-4-2-1-3-5-6/h2,4,6-7,10H,1,3,5H2.
What are the key properties of N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide?
N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide has a molecular weight of 211.23 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohex-2-en-1-yl-1,1-difluoromethanesulfonamide is sourced from PubChem (CID 130628533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).