C11H16N4O — CID 13062863
2,4-dimethyl-6-(2-methylphenyl)-1,2,4,5-tetrazinan-3-one (PubChem CID 13062863) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2,4-dimethyl-6-(2-methylphenyl)-1,2,4,5-tetrazinan-3-one.
| Compound Name | 2,4-dimethyl-6-(2-methylphenyl)-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 13062863 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2,4-dimethyl-6-(2-methylphenyl)-1,2,4,5-tetrazinan-3-one |
| SMILES | Cc1ccccc1C1NN(C)C(=O)N(C)N1 |
| InChI | InChI=1S/C11H16N4O/c1-8-6-4-5-7-9(8)10-12-14(2)11(16)15(3)13-10/h4-7,10,12-13H,1-3H3 |
| InChIKey | FILUIILHDYJRNG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |