About (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine
(NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine (PubChem CID 13062910) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine |
| PubChem CID | 13062910 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine |
| SMILES | Cc1oc2ccccc2/c(=N/O)c1C |
| InChI | InChI=1S/C11H11NO2/c1-7-8(2)14-10-6-4-3-5-9(10)11(7)12-13/h3-6,13H,1-2H3/b12-11+ |
| InChIKey | AQVFBWREWDIEIG-VAWYXSNFSA-N |
| XLogP | 2.34 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine?
The IUPAC name of (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine (CID 13062910) is (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine.
What is the SMILES notation for (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine?
The canonical SMILES for (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine is Cc1oc2ccccc2/c(=N/O)c1C.
What is the InChIKey of (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine?
The InChIKey is AQVFBWREWDIEIG-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H11NO2/c1-7-8(2)14-10-6-4-3-5-9(10)11(7)12-13/h3-6,13H,1-2H3/b12-11+.
What are the key properties of (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine?
(NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine has a molecular weight of 189.21 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(2,3-dimethylchromen-4-ylidene)hydroxylamine is sourced from PubChem (CID 13062910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).