C10H19FN2 — CID 130629155
1-(2-fluoroethyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 130629155) has the molecular formula C10H19FN2 and a molecular weight of 186.27 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | 1-(2-fluoroethyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 130629155 |
| Molecular Formula | C10H19FN2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 1-(2-fluoroethyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | CN1CCC2CCN(CCF)C2C1 |
| InChI | InChI=1S/C10H19FN2/c1-12-5-2-9-3-6-13(7-4-11)10(9)8-12/h9-10H,2-8H2,1H3 |
| InChIKey | BZYVHRKPIYJUDM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |