About 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone
2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone (PubChem CID 13062918) has the molecular formula C17H14N2O2
and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone.
Molecular Properties
| Compound Name | 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone |
| PubChem CID | 13062918 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone |
| SMILES | O=C(n1ccnc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14N2O2/c20-16(19-12-11-18-13-19)17(21,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,21H |
| InChIKey | QPSFATQUKFVNRT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone?
The IUPAC name of 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone (CID 13062918) is 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone.
What is the SMILES notation for 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone?
The canonical SMILES for 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone is O=C(n1ccnc1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone?
The InChIKey is QPSFATQUKFVNRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O2/c20-16(19-12-11-18-13-19)17(21,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,21H.
What are the key properties of 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone?
2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone has a molecular weight of 278.31 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-imidazol-1-yl-2,2-diphenylethanone is sourced from PubChem (CID 13062918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).