C15H12N2O2 — CID 13063059
(5R)-2,5-diphenyl-4,5-dihydro-1,3,4-oxadiazin-6-one (PubChem CID 13063059) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is (5R)-2,5-diphenyl-4,5-dihydro-1,3,4-oxadiazin-6-one.
| Compound Name | (5R)-2,5-diphenyl-4,5-dihydro-1,3,4-oxadiazin-6-one |
|---|---|
| PubChem CID | 13063059 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (5R)-2,5-diphenyl-4,5-dihydro-1,3,4-oxadiazin-6-one |
| SMILES | O=C1OC(c2ccccc2)=NN[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H12N2O2/c18-15-13(11-7-3-1-4-8-11)16-17-14(19-15)12-9-5-2-6-10-12/h1-10,13,16H/t13-/m1/s1 |
| InChIKey | MDDCRRYRJVAXHV-CYBMUJFWSA-N |
| XLogP | 2.24 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |