About 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide
1-ethyl-3,5-dimethylpyrazole-4-carboximidamide (PubChem CID 130631217) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide.
Molecular Properties
| Compound Name | 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide |
| PubChem CID | 130631217 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(CC)c1C |
| InChI | InChI=1S/C8H14N4/c1-4-12-6(3)7(8(9)10)5(2)11-12/h4H2,1-3H3,(H3,9,10) |
| InChIKey | MCIPTSQPCPYAMR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide?
The IUPAC name of 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide (CID 130631217) is 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide.
What is the SMILES notation for 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide?
The canonical SMILES for 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide is [H]/N=C(\N)c1c(C)nn(CC)c1C.
What is the InChIKey of 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide?
The InChIKey is MCIPTSQPCPYAMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-4-12-6(3)7(8(9)10)5(2)11-12/h4H2,1-3H3,(H3,9,10).
What are the key properties of 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide?
1-ethyl-3,5-dimethylpyrazole-4-carboximidamide has a molecular weight of 166.23 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-dimethylpyrazole-4-carboximidamide is sourced from PubChem (CID 130631217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).