About 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone
2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone (PubChem CID 130631721) has the molecular formula C6H6BrF4NO
and a molecular weight of 264.02 g/mol. Its IUPAC name is 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone |
| PubChem CID | 130631721 |
| Molecular Formula | C6H6BrF4NO |
| Molecular Weight | 264.02 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone |
| SMILES | O=C(CBr)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C6H6BrF4NO/c7-1-4(13)12-2-5(8,9)6(10,11)3-12/h1-3H2 |
| InChIKey | TYOQMWVSCXUQHT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.02 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone?
The IUPAC name of 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone (CID 130631721) is 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone.
What is the SMILES notation for 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone?
The canonical SMILES for 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone is O=C(CBr)N1CC(F)(F)C(F)(F)C1.
What is the InChIKey of 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone?
The InChIKey is TYOQMWVSCXUQHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrF4NO/c7-1-4(13)12-2-5(8,9)6(10,11)3-12/h1-3H2.
What are the key properties of 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone?
2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone has a molecular weight of 264.02 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone is sourced from PubChem (CID 130631721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).