C22H28F3NO4SSi — CID 13063201
[(Z)-[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 13063201) has the molecular formula C22H28F3NO4SSi and a molecular weight of 487.62 g/mol. Its IUPAC name is [(Z)-[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13063201 |
| Molecular Formula | C22H28F3NO4SSi |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | [(Z)-[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/N=C(/c2ccc(CO[Si](C)(C)C(C)(C)C)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H28F3NO4SSi/c1-16-7-13-19(14-8-16)31(27,28)30-26-20(22(23,24)25)18-11-9-17(10-12-18)15-29-32(5,6)21(2,3)4/h7-14H,15H2,1-6H3/b26-20- |
| InChIKey | QGOUWLJEIYYHJB-QOMWVZHYSA-N |
| XLogP | 6.19 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|