About 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione
3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione (PubChem CID 130632135) has the molecular formula C8H9F3N2S
and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione.
Molecular Properties
| Compound Name | 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione |
| PubChem CID | 130632135 |
| Molecular Formula | C8H9F3N2S |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione |
| SMILES | N[C@@H](CC(F)(F)F)c1ccc[nH]c1=S |
| InChI | InChI=1S/C8H9F3N2S/c9-8(10,11)4-6(12)5-2-1-3-13-7(5)14/h1-3,6H,4,12H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | HBOTUACPENKZBB-LURJTMIESA-N |
| XLogP | 2.70 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione?
The IUPAC name of 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione (CID 130632135) is 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione.
What is the SMILES notation for 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione?
The canonical SMILES for 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione is N[C@@H](CC(F)(F)F)c1ccc[nH]c1=S.
What is the InChIKey of 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione?
The InChIKey is HBOTUACPENKZBB-LURJTMIESA-N. The full InChI is InChI=1S/C8H9F3N2S/c9-8(10,11)4-6(12)5-2-1-3-13-7(5)14/h1-3,6H,4,12H2,(H,13,14)/t6-/m0/s1.
What are the key properties of 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione?
3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione has a molecular weight of 222.24 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-1-amino-3,3,3-trifluoropropyl]-1H-pyridine-2-thione is sourced from PubChem (CID 130632135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).