About N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide
N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 130634246) has the molecular formula C6H8N2O3S
and a molecular weight of 188.21 g/mol. Its IUPAC name is N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
| PubChem CID | 130634246 |
| Molecular Formula | C6H8N2O3S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | CONC(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C6H8N2O3S/c1-11-7-5(9)4-8-2-3-12-6(8)10/h2-3H,4H2,1H3,(H,7,9) |
| InChIKey | KLBARBBIIFWVKJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide?
The IUPAC name of N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide (CID 130634246) is N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide.
What is the SMILES notation for N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide?
The canonical SMILES for N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide is CONC(=O)Cn1ccsc1=O.
What is the InChIKey of N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide?
The InChIKey is KLBARBBIIFWVKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3S/c1-11-7-5(9)4-8-2-3-12-6(8)10/h2-3H,4H2,1H3,(H,7,9).
What are the key properties of N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide?
N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide has a molecular weight of 188.21 g/mol, XLogP of -0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-2-(2-oxo-1,3-thiazol-3-yl)acetamide is sourced from PubChem (CID 130634246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).