C9H14BrNO — CID 130634322
N-(2-bromoprop-2-enyl)-1-methylcyclobutane-1-carboxamide (PubChem CID 130634322) has the molecular formula C9H14BrNO and a molecular weight of 232.12 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-1-methylcyclobutane-1-carboxamide.
| Compound Name | N-(2-bromoprop-2-enyl)-1-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 130634322 |
| Molecular Formula | C9H14BrNO |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-1-methylcyclobutane-1-carboxamide |
| SMILES | C=C(Br)CNC(=O)C1(C)CCC1 |
| InChI | InChI=1S/C9H14BrNO/c1-7(10)6-11-8(12)9(2)4-3-5-9/h1,3-6H2,2H3,(H,11,12) |
| InChIKey | CCERSAYKBDTAAC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.12 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |