About N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide
N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide (PubChem CID 130634393) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide.
Molecular Properties
| Compound Name | N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide |
| PubChem CID | 130634393 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide |
| SMILES | CC1(NC(=O)C2=CCCO2)CCC1 |
| InChI | InChI=1S/C10H15NO2/c1-10(5-3-6-10)11-9(12)8-4-2-7-13-8/h4H,2-3,5-7H2,1H3,(H,11,12) |
| InChIKey | RMTXNYUGWYHBNA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide?
The IUPAC name of N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide (CID 130634393) is N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide.
What is the SMILES notation for N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide?
The canonical SMILES for N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide is CC1(NC(=O)C2=CCCO2)CCC1.
What is the InChIKey of N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide?
The InChIKey is RMTXNYUGWYHBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-10(5-3-6-10)11-9(12)8-4-2-7-13-8/h4H,2-3,5-7H2,1H3,(H,11,12).
What are the key properties of N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide?
N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide has a molecular weight of 181.23 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide is sourced from PubChem (CID 130634393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).