About cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate
cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate (PubChem CID 130634584) has the molecular formula C7H7N3O3
and a molecular weight of 181.15 g/mol. Its IUPAC name is cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate.
Molecular Properties
| Compound Name | cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
| PubChem CID | 130634584 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
| SMILES | N#CCOC(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C7H7N3O3/c8-3-4-13-7(12)5-1-2-6(11)10-9-5/h1-2,4H2,(H,10,11) |
| InChIKey | IPEPRSDMAKOCJV-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
The IUPAC name of cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate (CID 130634584) is cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate.
What is the SMILES notation for cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
The canonical SMILES for cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate is N#CCOC(=O)C1=NNC(=O)CC1.
What is the InChIKey of cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
The InChIKey is IPEPRSDMAKOCJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O3/c8-3-4-13-7(12)5-1-2-6(11)10-9-5/h1-2,4H2,(H,10,11).
What are the key properties of cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate has a molecular weight of 181.15 g/mol, XLogP of -0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate is sourced from PubChem (CID 130634584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).