About 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine
3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine (PubChem CID 130636107) has the molecular formula C10H13BrN2S
and a molecular weight of 273.20 g/mol. Its IUPAC name is 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine.
Molecular Properties
| Compound Name | 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine |
| PubChem CID | 130636107 |
| Molecular Formula | C10H13BrN2S |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine |
| SMILES | CC1(C)SCC1Nc1ccncc1Br |
| InChI | InChI=1S/C10H13BrN2S/c1-10(2)9(6-14-10)13-8-3-4-12-5-7(8)11/h3-5,9H,6H2,1-2H3,(H,12,13) |
| InChIKey | AUQQIUKXOAFSJT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine?
The IUPAC name of 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine (CID 130636107) is 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine.
What is the SMILES notation for 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine?
The canonical SMILES for 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine is CC1(C)SCC1Nc1ccncc1Br.
What is the InChIKey of 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine?
The InChIKey is AUQQIUKXOAFSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2S/c1-10(2)9(6-14-10)13-8-3-4-12-5-7(8)11/h3-5,9H,6H2,1-2H3,(H,12,13).
What are the key properties of 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine?
3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine has a molecular weight of 273.20 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-4-amine is sourced from PubChem (CID 130636107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).