About 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine
1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine (PubChem CID 130636516) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine.
Molecular Properties
| Compound Name | 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine |
| PubChem CID | 130636516 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine |
| SMILES | Cc1nc(CN2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C9H16N4/c1-8-10-9(12-11-8)7-13-5-3-2-4-6-13/h2-7H2,1H3,(H,10,11,12) |
| InChIKey | WSQZSFMIGXGOHT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine?
The IUPAC name of 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine (CID 130636516) is 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine.
What is the SMILES notation for 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine?
The canonical SMILES for 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine is Cc1nc(CN2CCCCC2)n[nH]1.
What is the InChIKey of 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine?
The InChIKey is WSQZSFMIGXGOHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-8-10-9(12-11-8)7-13-5-3-2-4-6-13/h2-7H2,1H3,(H,10,11,12).
What are the key properties of 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine?
1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine has a molecular weight of 180.25 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperidine is sourced from PubChem (CID 130636516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).