About 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole
5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole (PubChem CID 130636634) has the molecular formula C9H14FN3
and a molecular weight of 183.23 g/mol. Its IUPAC name is 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole |
| PubChem CID | 130636634 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole |
| SMILES | Cc1cnn(C)c1CN1CC(F)C1 |
| InChI | InChI=1S/C9H14FN3/c1-7-3-11-12(2)9(7)6-13-4-8(10)5-13/h3,8H,4-6H2,1-2H3 |
| InChIKey | WCOMPPPUKLLWOA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole?
The IUPAC name of 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole (CID 130636634) is 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole.
What is the SMILES notation for 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole?
The canonical SMILES for 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole is Cc1cnn(C)c1CN1CC(F)C1.
What is the InChIKey of 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole?
The InChIKey is WCOMPPPUKLLWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3/c1-7-3-11-12(2)9(7)6-13-4-8(10)5-13/h3,8H,4-6H2,1-2H3.
What are the key properties of 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole?
5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole has a molecular weight of 183.23 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-fluoroazetidin-1-yl)methyl]-1,4-dimethylpyrazole is sourced from PubChem (CID 130636634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).