C7H11N3OS2 — CID 130636649
4-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine (PubChem CID 130636649) has the molecular formula C7H11N3OS2 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine.
| Compound Name | 4-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 130636649 |
| Molecular Formula | C7H11N3OS2 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 4-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine |
| SMILES | CSc1nnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C7H11N3OS2/c1-12-7-9-8-6(13-7)10-2-4-11-5-3-10/h2-5H2,1H3 |
| InChIKey | LXZZOOOEQPCHKI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |