C9H17ClN2O — CID 130636827
N-[(2S)-1-aminopropan-2-yl]-2-cyclobutylideneacetamide;hydrochloride (PubChem CID 130636827) has the molecular formula C9H17ClN2O and a molecular weight of 204.70 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-cyclobutylideneacetamide;hydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-cyclobutylideneacetamide;hydrochloride |
|---|---|
| PubChem CID | 130636827 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-cyclobutylideneacetamide;hydrochloride |
| SMILES | C[C@@H](CN)NC(=O)C=C1CCC1.Cl |
| InChI | InChI=1S/C9H16N2O.ClH/c1-7(6-10)11-9(12)5-8-3-2-4-8;/h5,7H,2-4,6,10H2,1H3,(H,11,12);1H/t7-;/m0./s1 |
| InChIKey | DSHCKYMZUNOXJY-FJXQXJEOSA-N |
| XLogP | 0.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|