About N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide
N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide (PubChem CID 130636863) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide |
| PubChem CID | 130636863 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC2)nnn1C |
| InChI | InChI=1S/C8H12N4O/c1-5-7(10-11-12(5)2)8(13)9-6-3-4-6/h6H,3-4H2,1-2H3,(H,9,13) |
| InChIKey | UIGPPTATZHMHBQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide?
The IUPAC name of N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide (CID 130636863) is N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide.
What is the SMILES notation for N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide?
The canonical SMILES for N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide is Cc1c(C(=O)NC2CC2)nnn1C.
What is the InChIKey of N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide?
The InChIKey is UIGPPTATZHMHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c1-5-7(10-11-12(5)2)8(13)9-6-3-4-6/h6H,3-4H2,1-2H3,(H,9,13).
What are the key properties of N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide?
N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide has a molecular weight of 180.21 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-1,5-dimethyltriazole-4-carboxamide is sourced from PubChem (CID 130636863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).