C8H16N4S — CID 130636868
1-(2,3,3-trimethylbutan-2-yl)-2H-tetrazole-5-thione (PubChem CID 130636868) has the molecular formula C8H16N4S and a molecular weight of 200.31 g/mol. Its IUPAC name is 1-(2,3,3-trimethylbutan-2-yl)-2H-tetrazole-5-thione.
| Compound Name | 1-(2,3,3-trimethylbutan-2-yl)-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 130636868 |
| Molecular Formula | C8H16N4S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-(2,3,3-trimethylbutan-2-yl)-2H-tetrazole-5-thione |
| SMILES | CC(C)(C)C(C)(C)n1[nH]nnc1=S |
| InChI | InChI=1S/C8H16N4S/c1-7(2,3)8(4,5)12-6(13)9-10-11-12/h1-5H3,(H,9,11,13) |
| InChIKey | MKPDYFVCZVQNDK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|