C9H13F2NO — CID 130637163
1-(5-azaspiro[3.4]octan-5-yl)-2,2-difluoroethanone (PubChem CID 130637163) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is 1-(5-azaspiro[3.4]octan-5-yl)-2,2-difluoroethanone.
| Compound Name | 1-(5-azaspiro[3.4]octan-5-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 130637163 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 1-(5-azaspiro[3.4]octan-5-yl)-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)N1CCCC12CCC2 |
| InChI | InChI=1S/C9H13F2NO/c10-7(11)8(13)12-6-2-5-9(12)3-1-4-9/h7H,1-6H2 |
| InChIKey | MUAGAAVZHUDJOI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |